About S-(furan-2-ylmethyl) 3-methylbut-2-enethioate
S-(furan-2-ylmethyl) 3-methylbut-2-enethioate (PubChem CID 57051934) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is S-(furan-2-ylmethyl) 3-methylbut-2-enethioate.
Molecular Properties
| Compound Name | S-(furan-2-ylmethyl) 3-methylbut-2-enethioate |
| PubChem CID | 57051934 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | S-(furan-2-ylmethyl) 3-methylbut-2-enethioate |
| SMILES | CC(C)=CC(=O)SCc1ccco1 |
| InChI | InChI=1S/C10H12O2S/c1-8(2)6-10(11)13-7-9-4-3-5-12-9/h3-6H,7H2,1-2H3 |
| InChIKey | RGMHARGTEBVBHQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(furan-2-ylmethyl) 3-methylbut-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(furan-2-ylmethyl) 3-methylbut-2-enethioate?
The IUPAC name of S-(furan-2-ylmethyl) 3-methylbut-2-enethioate (CID 57051934) is S-(furan-2-ylmethyl) 3-methylbut-2-enethioate.
What is the SMILES notation for S-(furan-2-ylmethyl) 3-methylbut-2-enethioate?
The canonical SMILES for S-(furan-2-ylmethyl) 3-methylbut-2-enethioate is CC(C)=CC(=O)SCc1ccco1.
What is the InChIKey of S-(furan-2-ylmethyl) 3-methylbut-2-enethioate?
The InChIKey is RGMHARGTEBVBHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-8(2)6-10(11)13-7-9-4-3-5-12-9/h3-6H,7H2,1-2H3.
What are the key properties of S-(furan-2-ylmethyl) 3-methylbut-2-enethioate?
S-(furan-2-ylmethyl) 3-methylbut-2-enethioate has a molecular weight of 196.27 g/mol, XLogP of 3.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(furan-2-ylmethyl) 3-methylbut-2-enethioate is sourced from PubChem (CID 57051934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).