C18H18O5S3 — CID 88542367
2,2,3-tris(furan-2-ylmethylsulfanyl)propanoic acid (PubChem CID 88542367) has the molecular formula C18H18O5S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is 2,2,3-tris(furan-2-ylmethylsulfanyl)propanoic acid.
| Compound Name | 2,2,3-tris(furan-2-ylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 88542367 |
| Molecular Formula | C18H18O5S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2,2,3-tris(furan-2-ylmethylsulfanyl)propanoic acid |
| SMILES | O=C(O)C(CSCc1ccco1)(SCc1ccco1)SCc1ccco1 |
| InChI | InChI=1S/C18H18O5S3/c19-17(20)18(25-11-15-5-2-8-22-15,26-12-16-6-3-9-23-16)13-24-10-14-4-1-7-21-14/h1-9H,10-13H2,(H,19,20) |
| InChIKey | XYRRRDBXIQAORF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|