C19H28O — CID 170313495
2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]furan (PubChem CID 170313495) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]furan.
| Compound Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]furan |
|---|---|
| PubChem CID | 170313495 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]furan |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/Cc1ccco1 |
| InChI | InChI=1S/C19H28O/c1-16(2)8-5-9-17(3)10-6-11-18(4)13-14-19-12-7-15-20-19/h7-8,10,12-13,15H,5-6,9,11,14H2,1-4H3/b17-10+,18-13+ |
| InChIKey | PSNZAOOOEJFHJU-YAUBYZHOSA-N |
| XLogP | 6.24 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|