C19H29N — CID 53325757
2-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole (PubChem CID 53325757) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole.
| Compound Name | 2-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole |
|---|---|
| PubChem CID | 53325757 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\Cc1ccc[nH]1 |
| InChI | InChI=1S/C19H29N/c1-16(2)8-5-9-17(3)10-6-11-18(4)13-14-19-12-7-15-20-19/h7-8,10,12-13,15,20H,5-6,9,11,14H2,1-4H3/b17-10-,18-13- |
| InChIKey | VUXRFHFDHMATNZ-MMDZXYDWSA-N |
| XLogP | 5.98 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|