C11H16O4 — CID 14865541
dimethyl 2-[(2E)-3-methylpenta-2,4-dienyl]propanedioate (PubChem CID 14865541) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is dimethyl 2-[(2E)-3-methylpenta-2,4-dienyl]propanedioate.
| Compound Name | dimethyl 2-[(2E)-3-methylpenta-2,4-dienyl]propanedioate |
|---|---|
| PubChem CID | 14865541 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | dimethyl 2-[(2E)-3-methylpenta-2,4-dienyl]propanedioate |
| SMILES | C=C/C(C)=C/CC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H16O4/c1-5-8(2)6-7-9(10(12)14-3)11(13)15-4/h5-6,9H,1,7H2,2-4H3/b8-6+ |
| InChIKey | SWLPWYUUCGKOKR-SOFGYWHQSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|