About disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate
disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate (PubChem CID 174803135) has the molecular formula C10H16Na2O5
and a molecular weight of 262.21 g/mol. Its IUPAC name is disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate.
Molecular Properties
| Compound Name | disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate |
| PubChem CID | 174803135 |
| Molecular Formula | C10H16Na2O5 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate |
| SMILES | C=CC(=O)OC(=O)C(CCC)C(=O)OC.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C10H14O5.2Na.2H/c1-4-6-7(9(12)14-3)10(13)15-8(11)5-2;;;;/h5,7H,2,4,6H2,1,3H3;;;;/q;2*+1;2*-1 |
| InChIKey | SBDAQZATNAQOJF-UHFFFAOYSA-N |
| XLogP | -4.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate?
The IUPAC name of disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate (CID 174803135) is disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate.
What is the SMILES notation for disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate?
The canonical SMILES for disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate is C=CC(=O)OC(=O)C(CCC)C(=O)OC.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate?
The InChIKey is SBDAQZATNAQOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5.2Na.2H/c1-4-6-7(9(12)14-3)10(13)15-8(11)5-2;;;;/h5,7H,2,4,6H2,1,3H3;;;;/q;2*+1;2*-1.
What are the key properties of disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate?
disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate has a molecular weight of 262.21 g/mol, XLogP of -4.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;1-O-methyl 3-O-prop-2-enoyl 2-propylpropanedioate is sourced from PubChem (CID 174803135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).