C10H19NO4 — CID 162816355
[(2R)-1-amino-3-methyl-1-oxobutan-2-yl] (2R)-2-hydroxy-3-methylbutanoate (PubChem CID 162816355) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is [(2R)-1-amino-3-methyl-1-oxobutan-2-yl] (2R)-2-hydroxy-3-methylbutanoate.
| Compound Name | [(2R)-1-amino-3-methyl-1-oxobutan-2-yl] (2R)-2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 162816355 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | [(2R)-1-amino-3-methyl-1-oxobutan-2-yl] (2R)-2-hydroxy-3-methylbutanoate |
| SMILES | CC(C)[C@@H](O)C(=O)O[C@@H](C(N)=O)C(C)C |
| InChI | InChI=1S/C10H19NO4/c1-5(2)7(12)10(14)15-8(6(3)4)9(11)13/h5-8,12H,1-4H3,(H2,11,13)/t7-,8-/m1/s1 |
| InChIKey | AFQXBFSUWNVPRZ-HTQZYQBOSA-N |
| XLogP | 0.06 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |