C5H9N3O6 — CID 163737512
[(2S,3S)-1-amino-3-carbamoyloxy-3-hydroxy-1-oxopropan-2-yl] carbamate (PubChem CID 163737512) has the molecular formula C5H9N3O6 and a molecular weight of 207.14 g/mol. Its IUPAC name is [(2S,3S)-1-amino-3-carbamoyloxy-3-hydroxy-1-oxopropan-2-yl] carbamate.
| Compound Name | [(2S,3S)-1-amino-3-carbamoyloxy-3-hydroxy-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 163737512 |
| Molecular Formula | C5H9N3O6 |
| Molecular Weight | 207.14 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | [(2S,3S)-1-amino-3-carbamoyloxy-3-hydroxy-1-oxopropan-2-yl] carbamate |
| SMILES | NC(=O)O[C@H](C(N)=O)[C@@H](O)OC(N)=O |
| InChI | InChI=1S/C5H9N3O6/c6-2(9)1(13-4(7)11)3(10)14-5(8)12/h1,3,10H,(H2,6,9)(H2,7,11)(H2,8,12)/t1-,3+/m1/s1 |
| InChIKey | LEXBSSRFZAHYOW-GPKNORDASA-N |
| XLogP | -2.65 |
| TPSA | 167.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.14 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|