C8H18O6 — CID 88961080
(2R,3R,4S,5R)-5,6-dimethoxyhexane-1,2,3,4-tetrol (PubChem CID 88961080) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5,6-dimethoxyhexane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4S,5R)-5,6-dimethoxyhexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 88961080 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2R,3R,4S,5R)-5,6-dimethoxyhexane-1,2,3,4-tetrol |
| SMILES | COC[C@@H](OC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H18O6/c1-13-4-6(14-2)8(12)7(11)5(10)3-9/h5-12H,3-4H2,1-2H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | TVLZYYUWDVXSOY-WCTZXXKLSA-N |
| XLogP | -2.28 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |