C9H15NO7 — CID 91443816
(2S,3S,4R,5R)-5-acetamido-2,4-dihydroxy-3-methoxy-6-oxohexanoic acid (PubChem CID 91443816) has the molecular formula C9H15NO7 and a molecular weight of 249.22 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-acetamido-2,4-dihydroxy-3-methoxy-6-oxohexanoic acid.
| Compound Name | (2S,3S,4R,5R)-5-acetamido-2,4-dihydroxy-3-methoxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 91443816 |
| Molecular Formula | C9H15NO7 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2S,3S,4R,5R)-5-acetamido-2,4-dihydroxy-3-methoxy-6-oxohexanoic acid |
| SMILES | CO[C@@H]([C@H](O)[C@H](C=O)NC(C)=O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C9H15NO7/c1-4(12)10-5(3-11)6(13)8(17-2)7(14)9(15)16/h3,5-8,13-14H,1-2H3,(H,10,12)(H,15,16)/t5-,6+,7-,8-/m0/s1 |
| InChIKey | WLRQZUVQJYVYAU-YWIQKCBGSA-N |
| XLogP | -2.49 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|