C10H17NO7 — CID 118543059
[(2R,3S,4R,5S)-5-acetamido-1,2,4-trihydroxy-6-oxohexan-3-yl] acetate (PubChem CID 118543059) has the molecular formula C10H17NO7 and a molecular weight of 263.25 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-acetamido-1,2,4-trihydroxy-6-oxohexan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-5-acetamido-1,2,4-trihydroxy-6-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 118543059 |
| Molecular Formula | C10H17NO7 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | [(2R,3S,4R,5S)-5-acetamido-1,2,4-trihydroxy-6-oxohexan-3-yl] acetate |
| SMILES | CC(=O)N[C@H](C=O)[C@@H](O)[C@H](OC(C)=O)[C@H](O)CO |
| InChI | InChI=1S/C10H17NO7/c1-5(14)11-7(3-12)9(17)10(8(16)4-13)18-6(2)15/h3,7-10,13,16-17H,4H2,1-2H3,(H,11,14)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | GCZMXQDGUJAUPB-ZYUZMQFOSA-N |
| XLogP | -2.66 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|