C8H15NO6 — CID 165412826
N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 165412826) has the molecular formula C8H15NO6 and a molecular weight of 223.21 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 165412826 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | N-[(2R,3R,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=[18O])N[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO6/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11/h2,5-8,11,13-15H,3H2,1H3,(H,9,12)/t5-,6+,7+,8-/m0/s1/i12+2 |
| InChIKey | MBLBDJOUHNCFQT-ULGGAGSYSA-N |
| XLogP | -3.23 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|