C14H27NO15S — CID 87422880
N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide;[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate (PubChem CID 87422880) has the molecular formula C14H27NO15S and a molecular weight of 481.43 g/mol. Its IUPAC name is N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide;[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate.
| Compound Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide;[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 87422880 |
| Molecular Formula | C14H27NO15S |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide;[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] hydrogen sulfate |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](OS(=O)(=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15NO6.C6H12O9S/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11;7-1-3(9)5(10)6(11)4(2-8)15-16(12,13)14/h2,5-8,11,13-15H,3H2,1H3,(H,9,12);2-7,9-11H,1H2,(H,12,13,14)/t5-,6+,7+,8+;3-,4+,5+,6-/m01/s1 |
| InChIKey | UQSYSVIMZVGASW-MXNFVIDDSA-N |
| XLogP | -6.79 |
| TPSA | 288.68 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | -6.79 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|