C14H28N2O14S — CID 88615099
[(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] hydrogen sulfate;N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 88615099) has the molecular formula C14H28N2O14S and a molecular weight of 480.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] hydrogen sulfate;N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | [(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] hydrogen sulfate;N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 88615099 |
| Molecular Formula | C14H28N2O14S |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] hydrogen sulfate;N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)O |
| InChI | InChI=1S/C8H15NO6.C6H13NO8S/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11;7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h2,5-8,11,13-15H,3H2,1H3,(H,9,12);1,3-6,9-11H,2,7H2,(H,12,13,14)/t5-,6+,7+,8+;3-,4+,5+,6+/m00/s1 |
| InChIKey | BSRFVNVJBPTXJT-GOBTYABZSA-N |
| XLogP | -6.82 |
| TPSA | 294.47 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | -6.82 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|