C12H23N3O9 — CID 174713919
2,4-diamino-4-oxobutanoic acid;N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)acetamide (PubChem CID 174713919) has the molecular formula C12H23N3O9 and a molecular weight of 353.33 g/mol. Its IUPAC name is 2,4-diamino-4-oxobutanoic acid;N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)acetamide.
| Compound Name | 2,4-diamino-4-oxobutanoic acid;N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)acetamide |
|---|---|
| PubChem CID | 174713919 |
| Molecular Formula | C12H23N3O9 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2,4-diamino-4-oxobutanoic acid;N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)acetamide |
| SMILES | CC(=O)NC(C=O)C(O)C(O)C(O)CO.NC(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C8H15NO6.C4H8N2O3/c1-4(12)9-5(2-10)7(14)8(15)6(13)3-11;5-2(4(8)9)1-3(6)7/h2,5-8,11,13-15H,3H2,1H3,(H,9,12);2H,1,5H2,(H2,6,7)(H,8,9) |
| InChIKey | ACJZZFOOCSLGPS-UHFFFAOYSA-N |
| XLogP | -4.96 |
| TPSA | 233.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|