C6H9F3O4 — CID 141384605
(2R,3S,4R)-5,5,5-trifluoro-2,3,4-trihydroxy-4-methylpentanal (PubChem CID 141384605) has the molecular formula C6H9F3O4 and a molecular weight of 202.13 g/mol. Its IUPAC name is (2R,3S,4R)-5,5,5-trifluoro-2,3,4-trihydroxy-4-methylpentanal.
| Compound Name | (2R,3S,4R)-5,5,5-trifluoro-2,3,4-trihydroxy-4-methylpentanal |
|---|---|
| PubChem CID | 141384605 |
| Molecular Formula | C6H9F3O4 |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (2R,3S,4R)-5,5,5-trifluoro-2,3,4-trihydroxy-4-methylpentanal |
| SMILES | C[C@@](O)([C@@H](O)[C@@H](O)C=O)C(F)(F)F |
| InChI | InChI=1S/C6H9F3O4/c1-5(13,6(7,8)9)4(12)3(11)2-10/h2-4,11-13H,1H3/t3-,4-,5+/m0/s1 |
| InChIKey | YTXYZRMEBNUIHP-VAYJURFESA-N |
| XLogP | -0.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|