C5H8O3 — CID 130749047
(2R,3S)-2-hydroxy-3-methylbutanedial (PubChem CID 130749047) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (2R,3S)-2-hydroxy-3-methylbutanedial.
| Compound Name | (2R,3S)-2-hydroxy-3-methylbutanedial |
|---|---|
| PubChem CID | 130749047 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (2R,3S)-2-hydroxy-3-methylbutanedial |
| SMILES | C[C@H](C=O)[C@@H](O)C=O |
| InChI | InChI=1S/C5H8O3/c1-4(2-6)5(8)3-7/h2-5,8H,1H3/t4-,5+/m1/s1 |
| InChIKey | KEIJBEOTIBZIKV-UHNVWZDZSA-N |
| XLogP | -0.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|