C7H10O7 — CID 174939298
2-hydroxy-3-oxo-2-(1,2,3-trihydroxypropyl)butanedial (PubChem CID 174939298) has the molecular formula C7H10O7 and a molecular weight of 206.15 g/mol. Its IUPAC name is 2-hydroxy-3-oxo-2-(1,2,3-trihydroxypropyl)butanedial.
| Compound Name | 2-hydroxy-3-oxo-2-(1,2,3-trihydroxypropyl)butanedial |
|---|---|
| PubChem CID | 174939298 |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-hydroxy-3-oxo-2-(1,2,3-trihydroxypropyl)butanedial |
| SMILES | O=CC(=O)C(O)(C=O)C(O)C(O)CO |
| InChI | InChI=1S/C7H10O7/c8-1-4(11)6(13)7(14,3-10)5(12)2-9/h2-4,6,8,11,13-14H,1H2 |
| InChIKey | AQQLDNBWLRRCLO-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|