C8H13N3O6 — CID 175317936
2-acetyl-4-azido-2,3,5,6-tetrahydroxyhexanal (PubChem CID 175317936) has the molecular formula C8H13N3O6 and a molecular weight of 247.21 g/mol. Its IUPAC name is 2-acetyl-4-azido-2,3,5,6-tetrahydroxyhexanal.
| Compound Name | 2-acetyl-4-azido-2,3,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 175317936 |
| Molecular Formula | C8H13N3O6 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-acetyl-4-azido-2,3,5,6-tetrahydroxyhexanal |
| SMILES | CC(=O)C(O)(C=O)C(O)C(N=[N+]=[N-])C(O)CO |
| InChI | InChI=1S/C8H13N3O6/c1-4(14)8(17,3-13)7(16)6(10-11-9)5(15)2-12/h3,5-7,12,15-17H,2H2,1H3 |
| InChIKey | BCQQBMBGXKVNFP-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 163.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|