C9H16O6 — CID 123227278
(2R,3S,4R,5R)-2-acetyl-2,3,5-trihydroxy-4-methoxyhexanal (PubChem CID 123227278) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-acetyl-2,3,5-trihydroxy-4-methoxyhexanal.
| Compound Name | (2R,3S,4R,5R)-2-acetyl-2,3,5-trihydroxy-4-methoxyhexanal |
|---|---|
| PubChem CID | 123227278 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2R,3S,4R,5R)-2-acetyl-2,3,5-trihydroxy-4-methoxyhexanal |
| SMILES | CO[C@H]([C@@H](C)O)[C@H](O)[C@@](O)(C=O)C(C)=O |
| InChI | InChI=1S/C9H16O6/c1-5(11)7(15-3)8(13)9(14,4-10)6(2)12/h4-5,7-8,11,13-14H,1-3H3/t5-,7-,8+,9-/m1/s1 |
| InChIKey | KRGNTLXCUSGVCN-BUJSFMDZSA-N |
| XLogP | -1.74 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|