C7H13NO6 — CID 91313490
(2R,3S,4R,5R)-2-formyl-2,3,4,5-tetrahydroxyhexanamide (PubChem CID 91313490) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-formyl-2,3,4,5-tetrahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-2-formyl-2,3,4,5-tetrahydroxyhexanamide |
|---|---|
| PubChem CID | 91313490 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2R,3S,4R,5R)-2-formyl-2,3,4,5-tetrahydroxyhexanamide |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[C@@](O)(C=O)C(N)=O |
| InChI | InChI=1S/C7H13NO6/c1-3(10)4(11)5(12)7(14,2-9)6(8)13/h2-5,10-12,14H,1H3,(H2,8,13)/t3-,4-,5+,7+/m1/s1 |
| InChIKey | IKWYCXZOCCMJEF-CXXDYQFHSA-N |
| XLogP | -3.50 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|