C8H15NO5 — CID 101194823
(3S,4S,5R)-5-hydroxy-4-methoxy-3-methyl-3-nitrohexanal (PubChem CID 101194823) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (3S,4S,5R)-5-hydroxy-4-methoxy-3-methyl-3-nitrohexanal.
| Compound Name | (3S,4S,5R)-5-hydroxy-4-methoxy-3-methyl-3-nitrohexanal |
|---|---|
| PubChem CID | 101194823 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (3S,4S,5R)-5-hydroxy-4-methoxy-3-methyl-3-nitrohexanal |
| SMILES | CO[C@H]([C@@H](C)O)[C@](C)(CC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO5/c1-6(11)7(14-3)8(2,4-5-10)9(12)13/h5-7,11H,4H2,1-3H3/t6-,7-,8+/m1/s1 |
| InChIKey | QHIGNXGXYIRVBL-PRJMDXOYSA-N |
| XLogP | 0.01 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|