C7H15NO3 — CID 101409838
(3R,4R,5R)-3-amino-4,5-dihydroxy-3-methylhexanal (PubChem CID 101409838) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (3R,4R,5R)-3-amino-4,5-dihydroxy-3-methylhexanal.
| Compound Name | (3R,4R,5R)-3-amino-4,5-dihydroxy-3-methylhexanal |
|---|---|
| PubChem CID | 101409838 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (3R,4R,5R)-3-amino-4,5-dihydroxy-3-methylhexanal |
| SMILES | C[C@@H](O)[C@H](O)[C@](C)(N)CC=O |
| InChI | InChI=1S/C7H15NO3/c1-5(10)6(11)7(2,8)3-4-9/h4-6,10-11H,3,8H2,1-2H3/t5-,6+,7-/m1/s1 |
| InChIKey | IJSNCWAAHIVVGJ-DSYKOEDSSA-N |
| XLogP | -0.97 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|