C3H5N3O8 — CID 175791015
2-methoxy-1,2,2-trinitroethanol (PubChem CID 175791015) has the molecular formula C3H5N3O8 and a molecular weight of 211.09 g/mol. Its IUPAC name is 2-methoxy-1,2,2-trinitroethanol.
| Compound Name | 2-methoxy-1,2,2-trinitroethanol |
|---|---|
| PubChem CID | 175791015 |
| Molecular Formula | C3H5N3O8 |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 2-methoxy-1,2,2-trinitroethanol |
| SMILES | COC(C(O)[N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N3O8/c1-14-3(5(10)11,6(12)13)2(7)4(8)9/h2,7H,1H3 |
| InChIKey | ZWEGXCFYIDLIBU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 158.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|