C10H20N2O5 — CID 58308991
2,5,6-trimethyl-2,6-dinitroheptan-3-ol (PubChem CID 58308991) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2,5,6-trimethyl-2,6-dinitroheptan-3-ol.
| Compound Name | 2,5,6-trimethyl-2,6-dinitroheptan-3-ol |
|---|---|
| PubChem CID | 58308991 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2,5,6-trimethyl-2,6-dinitroheptan-3-ol |
| SMILES | CC(CC(O)C(C)(C)[N+](=O)[O-])C(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H20N2O5/c1-7(9(2,3)11(14)15)6-8(13)10(4,5)12(16)17/h7-8,13H,6H2,1-5H3 |
| InChIKey | SPQRKHZJYHUBGE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|