C3H5ClN2O6 — CID 71411031
3-chloro-1,1-dinitropropane-1,2-diol (PubChem CID 71411031) has the molecular formula C3H5ClN2O6 and a molecular weight of 200.53 g/mol. Its IUPAC name is 3-chloro-1,1-dinitropropane-1,2-diol.
| Compound Name | 3-chloro-1,1-dinitropropane-1,2-diol |
|---|---|
| PubChem CID | 71411031 |
| Molecular Formula | C3H5ClN2O6 |
| Molecular Weight | 200.53 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 3-chloro-1,1-dinitropropane-1,2-diol |
| SMILES | O=[N+]([O-])C(O)(C(O)CCl)[N+](=O)[O-] |
| InChI | InChI=1S/C3H5ClN2O6/c4-1-2(7)3(8,5(9)10)6(11)12/h2,7-8H,1H2 |
| InChIKey | UQUYMFXCGAZHKC-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.53 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|