C2H2FN3O7 — CID 87384308
2-fluoro-1,2,2-trinitroethanol (PubChem CID 87384308) has the molecular formula C2H2FN3O7 and a molecular weight of 199.05 g/mol. Its IUPAC name is 2-fluoro-1,2,2-trinitroethanol.
| Compound Name | 2-fluoro-1,2,2-trinitroethanol |
|---|---|
| PubChem CID | 87384308 |
| Molecular Formula | C2H2FN3O7 |
| Molecular Weight | 199.05 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 2-fluoro-1,2,2-trinitroethanol |
| SMILES | O=[N+]([O-])C(O)C(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H2FN3O7/c3-2(5(10)11,6(12)13)1(7)4(8)9/h1,7H |
| InChIKey | RKUCVKYUHMEHNO-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.05 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|