C5H7FN4O10 — CID 57256619
5-fluoro-2,2,5,5-tetranitropentane-1,4-diol (PubChem CID 57256619) has the molecular formula C5H7FN4O10 and a molecular weight of 302.13 g/mol. Its IUPAC name is 5-fluoro-2,2,5,5-tetranitropentane-1,4-diol.
| Compound Name | 5-fluoro-2,2,5,5-tetranitropentane-1,4-diol |
|---|---|
| PubChem CID | 57256619 |
| Molecular Formula | C5H7FN4O10 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-fluoro-2,2,5,5-tetranitropentane-1,4-diol |
| SMILES | O=[N+]([O-])C(CO)(CC(O)C(F)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H7FN4O10/c6-5(9(17)18,10(19)20)3(12)1-4(2-11,7(13)14)8(15)16/h3,11-12H,1-2H2 |
| InChIKey | IPQWGOWPEKKDPQ-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 213.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|