C6H14N4O12 — CID 88697846
2,2-dinitrohexane-1,6-diol;bis(nitric acid) (PubChem CID 88697846) has the molecular formula C6H14N4O12 and a molecular weight of 334.19 g/mol. Its IUPAC name is 2,2-dinitrohexane-1,6-diol;bis(nitric acid).
| Compound Name | 2,2-dinitrohexane-1,6-diol;bis(nitric acid) |
|---|---|
| PubChem CID | 88697846 |
| Molecular Formula | C6H14N4O12 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2,2-dinitrohexane-1,6-diol;bis(nitric acid) |
| SMILES | O=[N+]([O-])C(CO)(CCCCO)[N+](=O)[O-].O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C6H12N2O6.2HNO3/c9-4-2-1-3-6(5-10,7(11)12)8(13)14;2*2-1(3)4/h9-10H,1-5H2;2*(H,2,3,4) |
| InChIKey | KYZXWCYBKGKKTR-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 253.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|