About 2-aminoethanol;bis(nitric acid)
2-aminoethanol;bis(nitric acid) (PubChem CID 22257240) has the molecular formula C2H9N3O7
and a molecular weight of 187.11 g/mol. Its IUPAC name is 2-aminoethanol;bis(nitric acid).
Molecular Properties
| Compound Name | 2-aminoethanol;bis(nitric acid) |
| PubChem CID | 22257240 |
| Molecular Formula | C2H9N3O7 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-aminoethanol;bis(nitric acid) |
| SMILES | NCCO.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C2H7NO.2HNO3/c3-1-2-4;2*2-1(3)4/h4H,1-3H2;2*(H,2,3,4) |
| InChIKey | OKZKZRACAIQAQK-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;bis(nitric acid)?
The IUPAC name of 2-aminoethanol;bis(nitric acid) (CID 22257240) is 2-aminoethanol;bis(nitric acid).
What is the SMILES notation for 2-aminoethanol;bis(nitric acid)?
The canonical SMILES for 2-aminoethanol;bis(nitric acid) is NCCO.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of 2-aminoethanol;bis(nitric acid)?
The InChIKey is OKZKZRACAIQAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.2HNO3/c3-1-2-4;2*2-1(3)4/h4H,1-3H2;2*(H,2,3,4).
What are the key properties of 2-aminoethanol;bis(nitric acid)?
2-aminoethanol;bis(nitric acid) has a molecular weight of 187.11 g/mol, XLogP of -1.76, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;bis(nitric acid) is sourced from PubChem (CID 22257240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).