C3H6BrNO5 — CID 54444419
2-bromo-2-nitropropane-1,1,3-triol (PubChem CID 54444419) has the molecular formula C3H6BrNO5 and a molecular weight of 215.99 g/mol. Its IUPAC name is 2-bromo-2-nitropropane-1,1,3-triol.
| Compound Name | 2-bromo-2-nitropropane-1,1,3-triol |
|---|---|
| PubChem CID | 54444419 |
| Molecular Formula | C3H6BrNO5 |
| Molecular Weight | 215.99 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | 2-bromo-2-nitropropane-1,1,3-triol |
| SMILES | O=[N+]([O-])C(Br)(CO)C(O)O |
| InChI | InChI=1S/C3H6BrNO5/c4-3(1-6,2(7)8)5(9)10/h2,6-8H,1H2 |
| InChIKey | WQMKKLKWRILNDX-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.99 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|