About 2-fluoro-2,2-dinitroethane-1,1-diol
2-fluoro-2,2-dinitroethane-1,1-diol (PubChem CID 57267178) has the molecular formula C2H3FN2O6
and a molecular weight of 170.05 g/mol. Its IUPAC name is 2-fluoro-2,2-dinitroethane-1,1-diol.
Molecular Properties
| Compound Name | 2-fluoro-2,2-dinitroethane-1,1-diol |
| PubChem CID | 57267178 |
| Molecular Formula | C2H3FN2O6 |
| Molecular Weight | 170.05 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 2-fluoro-2,2-dinitroethane-1,1-diol |
| SMILES | O=[N+]([O-])C(F)(C(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C2H3FN2O6/c3-2(1(6)7,4(8)9)5(10)11/h1,6-7H |
| InChIKey | BUYZTCTWPZNPFT-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.05 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-2,2-dinitroethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2,2-dinitroethane-1,1-diol?
The IUPAC name of 2-fluoro-2,2-dinitroethane-1,1-diol (CID 57267178) is 2-fluoro-2,2-dinitroethane-1,1-diol.
What is the SMILES notation for 2-fluoro-2,2-dinitroethane-1,1-diol?
The canonical SMILES for 2-fluoro-2,2-dinitroethane-1,1-diol is O=[N+]([O-])C(F)(C(O)O)[N+](=O)[O-].
What is the InChIKey of 2-fluoro-2,2-dinitroethane-1,1-diol?
The InChIKey is BUYZTCTWPZNPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3FN2O6/c3-2(1(6)7,4(8)9)5(10)11/h1,6-7H.
What are the key properties of 2-fluoro-2,2-dinitroethane-1,1-diol?
2-fluoro-2,2-dinitroethane-1,1-diol has a molecular weight of 170.05 g/mol, XLogP of -1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2,2-dinitroethane-1,1-diol is sourced from PubChem (CID 57267178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).