C2H3FN2O6 — CID 57267178
2-fluoro-2,2-dinitroethane-1,1-diol (PubChem CID 57267178) has the molecular formula C2H3FN2O6 and a molecular weight of 170.05 g/mol. Its IUPAC name is 2-fluoro-2,2-dinitroethane-1,1-diol.
| Compound Name | 2-fluoro-2,2-dinitroethane-1,1-diol |
|---|---|
| PubChem CID | 57267178 |
| Molecular Formula | C2H3FN2O6 |
| Molecular Weight | 170.05 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 2-fluoro-2,2-dinitroethane-1,1-diol |
| SMILES | O=[N+]([O-])C(F)(C(O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C2H3FN2O6/c3-2(1(6)7,4(8)9)5(10)11/h1,6-7H |
| InChIKey | BUYZTCTWPZNPFT-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.05 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|