C2Cl2F3NO2 — CID 23278501
1,2-dichloro-1,1,2-trifluoro-2-nitroethane (PubChem CID 23278501) has the molecular formula C2Cl2F3NO2 and a molecular weight of 197.93 g/mol. Its IUPAC name is 1,2-dichloro-1,1,2-trifluoro-2-nitroethane.
| Compound Name | 1,2-dichloro-1,1,2-trifluoro-2-nitroethane |
|---|---|
| PubChem CID | 23278501 |
| Molecular Formula | C2Cl2F3NO2 |
| Molecular Weight | 197.93 g/mol |
| Exact Mass | 196.93 |
| IUPAC Name | 1,2-dichloro-1,1,2-trifluoro-2-nitroethane |
| SMILES | O=[N+]([O-])C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C2Cl2F3NO2/c3-1(5,6)2(4,7)8(9)10 |
| InChIKey | SPBRNHHSNNOUNI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.93 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|