About sulfuryl difluoride;trichloro(nitro)methane
sulfuryl difluoride;trichloro(nitro)methane (PubChem CID 87077102) has the molecular formula CCl3F2NO4S
and a molecular weight of 266.44 g/mol. Its IUPAC name is sulfuryl difluoride;trichloro(nitro)methane.
Molecular Properties
| Compound Name | sulfuryl difluoride;trichloro(nitro)methane |
| PubChem CID | 87077102 |
| Molecular Formula | CCl3F2NO4S |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 264.86 |
| IUPAC Name | sulfuryl difluoride;trichloro(nitro)methane |
| SMILES | O=S(=O)(F)F.O=[N+]([O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/CCl3NO2.F2O2S/c2-1(3,4)5(6)7;1-5(2,3)4 |
| InChIKey | LVJNOBLNGAANOM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sulfuryl difluoride;trichloro(nitro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuryl difluoride;trichloro(nitro)methane?
The IUPAC name of sulfuryl difluoride;trichloro(nitro)methane (CID 87077102) is sulfuryl difluoride;trichloro(nitro)methane.
What is the SMILES notation for sulfuryl difluoride;trichloro(nitro)methane?
The canonical SMILES for sulfuryl difluoride;trichloro(nitro)methane is O=S(=O)(F)F.O=[N+]([O-])C(Cl)(Cl)Cl.
What is the InChIKey of sulfuryl difluoride;trichloro(nitro)methane?
The InChIKey is LVJNOBLNGAANOM-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl3NO2.F2O2S/c2-1(3,4)5(6)7;1-5(2,3)4.
What are the key properties of sulfuryl difluoride;trichloro(nitro)methane?
sulfuryl difluoride;trichloro(nitro)methane has a molecular weight of 266.44 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuryl difluoride;trichloro(nitro)methane is sourced from PubChem (CID 87077102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).