C7H6ClF3N6O15 — CID 14047294
2-[chloro-bis(2-fluoro-2,2-dinitroethoxy)methoxy]-1-fluoro-1,1-dinitroethane (PubChem CID 14047294) has the molecular formula C7H6ClF3N6O15 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-[chloro-bis(2-fluoro-2,2-dinitroethoxy)methoxy]-1-fluoro-1,1-dinitroethane.
| Compound Name | 2-[chloro-bis(2-fluoro-2,2-dinitroethoxy)methoxy]-1-fluoro-1,1-dinitroethane |
|---|---|
| PubChem CID | 14047294 |
| Molecular Formula | C7H6ClF3N6O15 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 505.95 |
| IUPAC Name | 2-[chloro-bis(2-fluoro-2,2-dinitroethoxy)methoxy]-1-fluoro-1,1-dinitroethane |
| SMILES | O=[N+]([O-])C(F)(COC(Cl)(OCC(F)([N+](=O)[O-])[N+](=O)[O-])OCC(F)([N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C7H6ClF3N6O15/c8-7(30-1-4(9,12(18)19)13(20)21,31-2-5(10,14(22)23)15(24)25)32-3-6(11,16(26)27)17(28)29/h1-3H2 |
| InChIKey | VXKRDMBANYEJAK-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 286.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|