C4H5FN2O6S — CID 15148562
(2-fluoro-2,2-dinitroethoxy)-methoxymethanethione (PubChem CID 15148562) has the molecular formula C4H5FN2O6S and a molecular weight of 228.16 g/mol. Its IUPAC name is (2-fluoro-2,2-dinitroethoxy)-methoxymethanethione.
| Compound Name | (2-fluoro-2,2-dinitroethoxy)-methoxymethanethione |
|---|---|
| PubChem CID | 15148562 |
| Molecular Formula | C4H5FN2O6S |
| Molecular Weight | 228.16 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | (2-fluoro-2,2-dinitroethoxy)-methoxymethanethione |
| SMILES | COC(=S)OCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H5FN2O6S/c1-12-3(14)13-2-4(5,6(8)9)7(10)11/h2H2,1H3 |
| InChIKey | NBBJCCZEKNQVFQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|