C7H8F4N2O8 — CID 154245654
[3-(2-fluoro-2,2-dinitroethoxy)-1-hydroxypropyl] 2,2,2-trifluoroacetate (PubChem CID 154245654) has the molecular formula C7H8F4N2O8 and a molecular weight of 324.14 g/mol. Its IUPAC name is [3-(2-fluoro-2,2-dinitroethoxy)-1-hydroxypropyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(2-fluoro-2,2-dinitroethoxy)-1-hydroxypropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154245654 |
| Molecular Formula | C7H8F4N2O8 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [3-(2-fluoro-2,2-dinitroethoxy)-1-hydroxypropyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(O)CCOCC(F)([N+](=O)[O-])[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C7H8F4N2O8/c8-6(12(16)17,13(18)19)3-20-2-1-4(14)21-5(15)7(9,10)11/h4,14H,1-3H2 |
| InChIKey | JRZSMWKMJKOTBL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|