C5H7FN2O6 — CID 119096859
1-(2-fluoro-2,2-dinitroethoxy)propan-2-one (PubChem CID 119096859) has the molecular formula C5H7FN2O6 and a molecular weight of 210.12 g/mol. Its IUPAC name is 1-(2-fluoro-2,2-dinitroethoxy)propan-2-one.
| Compound Name | 1-(2-fluoro-2,2-dinitroethoxy)propan-2-one |
|---|---|
| PubChem CID | 119096859 |
| Molecular Formula | C5H7FN2O6 |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 1-(2-fluoro-2,2-dinitroethoxy)propan-2-one |
| SMILES | CC(=O)COCC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H7FN2O6/c1-4(9)2-14-3-5(6,7(10)11)8(12)13/h2-3H2,1H3 |
| InChIKey | ITHJNINZPVUXIJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|