C8H7N9O22 — CID 21412081
2,2,2-trinitroethyl 2,2-bis(2,2,2-trinitroethoxy)acetate (PubChem CID 21412081) has the molecular formula C8H7N9O22 and a molecular weight of 581.18 g/mol. Its IUPAC name is 2,2,2-trinitroethyl 2,2-bis(2,2,2-trinitroethoxy)acetate.
| Compound Name | 2,2,2-trinitroethyl 2,2-bis(2,2,2-trinitroethoxy)acetate |
|---|---|
| PubChem CID | 21412081 |
| Molecular Formula | C8H7N9O22 |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 580.97 |
| IUPAC Name | 2,2,2-trinitroethyl 2,2-bis(2,2,2-trinitroethoxy)acetate |
| SMILES | O=C(OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])C(OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N9O22/c18-4(37-1-6(9(19)20,10(21)22)11(23)24)5(38-2-7(12(25)26,13(27)28)14(29)30)39-3-8(15(31)32,16(33)34)17(35)36/h5H,1-3H2 |
| InChIKey | RXMINRGOXQXHRY-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 433.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|