C3H6N4O6 — CID 23423628
3,3,3-trinitropropan-1-amine (PubChem CID 23423628) has the molecular formula C3H6N4O6 and a molecular weight of 194.10 g/mol. Its IUPAC name is 3,3,3-trinitropropan-1-amine.
| Compound Name | 3,3,3-trinitropropan-1-amine |
|---|---|
| PubChem CID | 23423628 |
| Molecular Formula | C3H6N4O6 |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3,3,3-trinitropropan-1-amine |
| SMILES | NCCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N4O6/c4-2-1-3(5(8)9,6(10)11)7(12)13/h1-2,4H2 |
| InChIKey | JUICPNATEFODEC-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|