About sulfane;trichloro(nitro)methane
sulfane;trichloro(nitro)methane (PubChem CID 158062482) has the molecular formula CH2Cl3NO2S
and a molecular weight of 198.46 g/mol. Its IUPAC name is sulfane;trichloro(nitro)methane.
Molecular Properties
| Compound Name | sulfane;trichloro(nitro)methane |
| PubChem CID | 158062482 |
| Molecular Formula | CH2Cl3NO2S |
| Molecular Weight | 198.46 g/mol |
| Exact Mass | 196.89 |
| IUPAC Name | sulfane;trichloro(nitro)methane |
| SMILES | O=[N+]([O-])C(Cl)(Cl)Cl.S |
| InChI | InChI=1S/CCl3NO2.H2S/c2-1(3,4)5(6)7;/h;1H2 |
| InChIKey | RAVRCXAREAPRJP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sulfane;trichloro(nitro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;trichloro(nitro)methane?
The IUPAC name of sulfane;trichloro(nitro)methane (CID 158062482) is sulfane;trichloro(nitro)methane.
What is the SMILES notation for sulfane;trichloro(nitro)methane?
The canonical SMILES for sulfane;trichloro(nitro)methane is O=[N+]([O-])C(Cl)(Cl)Cl.S.
What is the InChIKey of sulfane;trichloro(nitro)methane?
The InChIKey is RAVRCXAREAPRJP-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl3NO2.H2S/c2-1(3,4)5(6)7;/h;1H2.
What are the key properties of sulfane;trichloro(nitro)methane?
sulfane;trichloro(nitro)methane has a molecular weight of 198.46 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;trichloro(nitro)methane is sourced from PubChem (CID 158062482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).