C8N12O24 — CID 87483843
1,2,3,4-tetrakis(trinitromethyl)tricyclo[1.1.0.02,4]butane (PubChem CID 87483843) has the molecular formula C8N12O24 and a molecular weight of 648.15 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(trinitromethyl)tricyclo[1.1.0.02,4]butane.
| Compound Name | 1,2,3,4-tetrakis(trinitromethyl)tricyclo[1.1.0.02,4]butane |
|---|---|
| PubChem CID | 87483843 |
| Molecular Formula | C8N12O24 |
| Molecular Weight | 648.15 g/mol |
| Exact Mass | 647.91 |
| IUPAC Name | 1,2,3,4-tetrakis(trinitromethyl)tricyclo[1.1.0.02,4]butane |
| SMILES | O=[N+]([O-])C([N+](=O)[O-])([N+](=O)[O-])C12C3(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])C1(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])C23C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C8N12O24/c21-9(22)5(10(23)24,11(25)26)1-2(6(12(27)28,13(29)30)14(31)32)3(1,7(15(33)34,16(35)36)17(37)38)4(1,2)8(18(39)40,19(41)42)20(43)44 |
| InChIKey | ISEAXOQBOZTHHY-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 517.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.15 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|