C4H5Cl4NO3 — CID 119095722
1,1,1,3-tetrachloro-3-nitrobutan-2-ol (PubChem CID 119095722) has the molecular formula C4H5Cl4NO3 and a molecular weight of 256.90 g/mol. Its IUPAC name is 1,1,1,3-tetrachloro-3-nitrobutan-2-ol.
| Compound Name | 1,1,1,3-tetrachloro-3-nitrobutan-2-ol |
|---|---|
| PubChem CID | 119095722 |
| Molecular Formula | C4H5Cl4NO3 |
| Molecular Weight | 256.90 g/mol |
| Exact Mass | 254.90 |
| IUPAC Name | 1,1,1,3-tetrachloro-3-nitrobutan-2-ol |
| SMILES | CC(Cl)(C(O)C(Cl)(Cl)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C4H5Cl4NO3/c1-3(5,9(11)12)2(10)4(6,7)8/h2,10H,1H3 |
| InChIKey | ZZBKGYSTXFWIRE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.90 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|