C6H8N10O21 — CID 139202149
bis(2,2,2-trinitroethyl N-nitrocarbamate);hydrate (PubChem CID 139202149) has the molecular formula C6H8N10O21 and a molecular weight of 556.18 g/mol. Its IUPAC name is bis(2,2,2-trinitroethyl N-nitrocarbamate);hydrate.
| Compound Name | bis(2,2,2-trinitroethyl N-nitrocarbamate);hydrate |
|---|---|
| PubChem CID | 139202149 |
| Molecular Formula | C6H8N10O21 |
| Molecular Weight | 556.18 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | bis(2,2,2-trinitroethyl N-nitrocarbamate);hydrate |
| SMILES | O.O=C(N[N+](=O)[O-])OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-].O=C(N[N+](=O)[O-])OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/2C3H3N5O10.H2O/c2*9-2(4-8(16)17)18-1-3(5(10)11,6(12)13)7(14)15;/h2*1H2,(H,4,9);1H2 |
| InChIKey | XVPQBXRXKGOKIL-UHFFFAOYSA-N |
| XLogP | -4.05 |
| TPSA | 453.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.18 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|