About 1,3-dinitrourea
1,3-dinitrourea (PubChem CID 10866514) has the molecular formula CH2N4O5
and a molecular weight of 150.05 g/mol. Its IUPAC name is 1,3-dinitrourea.
Molecular Properties
| Compound Name | 1,3-dinitrourea |
| PubChem CID | 10866514 |
| Molecular Formula | CH2N4O5 |
| Molecular Weight | 150.05 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | 1,3-dinitrourea |
| SMILES | O=C(N[N+](=O)[O-])N[N+](=O)[O-] |
| InChI | InChI=1S/CH2N4O5/c6-1(2-4(7)8)3-5(9)10/h(H2,2,3,6) |
| InChIKey | JNECAQOEHMAUEJ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.05 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitrourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitrourea?
The IUPAC name of 1,3-dinitrourea (CID 10866514) is 1,3-dinitrourea.
What is the SMILES notation for 1,3-dinitrourea?
The canonical SMILES for 1,3-dinitrourea is O=C(N[N+](=O)[O-])N[N+](=O)[O-].
What is the InChIKey of 1,3-dinitrourea?
The InChIKey is JNECAQOEHMAUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2N4O5/c6-1(2-4(7)8)3-5(9)10/h(H2,2,3,6).
What are the key properties of 1,3-dinitrourea?
1,3-dinitrourea has a molecular weight of 150.05 g/mol, XLogP of -1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitrourea is sourced from PubChem (CID 10866514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).