CH2N4O5 — CID 10866514
1,3-dinitrourea (PubChem CID 10866514) has the molecular formula CH2N4O5 and a molecular weight of 150.05 g/mol. Its IUPAC name is 1,3-dinitrourea.
| Compound Name | 1,3-dinitrourea |
|---|---|
| PubChem CID | 10866514 |
| Molecular Formula | CH2N4O5 |
| Molecular Weight | 150.05 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | 1,3-dinitrourea |
| SMILES | O=C(N[N+](=O)[O-])N[N+](=O)[O-] |
| InChI | InChI=1S/CH2N4O5/c6-1(2-4(7)8)3-5(9)10/h(H2,2,3,6) |
| InChIKey | JNECAQOEHMAUEJ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.05 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|