About azane;hydroxylamine;N-hydroxynitramide
azane;hydroxylamine;N-hydroxynitramide (PubChem CID 173388904) has the molecular formula H11N5O5
and a molecular weight of 161.12 g/mol. Its IUPAC name is azane;hydroxylamine;N-hydroxynitramide.
Molecular Properties
| Compound Name | azane;hydroxylamine;N-hydroxynitramide |
| PubChem CID | 173388904 |
| Molecular Formula | H11N5O5 |
| Molecular Weight | 161.12 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | azane;hydroxylamine;N-hydroxynitramide |
| SMILES | N.NO.NO.O=[N+]([O-])NO |
| InChI | InChI=1S/H2N2O3.2H3NO.H3N/c3-1-2(4)5;2*1-2;/h1,3H;2*2H,1H2;1H3 |
| InChIKey | SRYIYNFUVDMVOO-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 202.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 161.12 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;hydroxylamine;N-hydroxynitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hydroxylamine;N-hydroxynitramide?
The IUPAC name of azane;hydroxylamine;N-hydroxynitramide (CID 173388904) is azane;hydroxylamine;N-hydroxynitramide.
What is the SMILES notation for azane;hydroxylamine;N-hydroxynitramide?
The canonical SMILES for azane;hydroxylamine;N-hydroxynitramide is N.NO.NO.O=[N+]([O-])NO.
What is the InChIKey of azane;hydroxylamine;N-hydroxynitramide?
The InChIKey is SRYIYNFUVDMVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O3.2H3NO.H3N/c3-1-2(4)5;2*1-2;/h1,3H;2*2H,1H2;1H3.
What are the key properties of azane;hydroxylamine;N-hydroxynitramide?
azane;hydroxylamine;N-hydroxynitramide has a molecular weight of 161.12 g/mol, XLogP of -2.01, 1 rotatable bonds, 7 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hydroxylamine;N-hydroxynitramide is sourced from PubChem (CID 173388904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).