About sodium;nitric hydrazide;hydroxide;hydrate
sodium;nitric hydrazide;hydroxide;hydrate (PubChem CID 174819631) has the molecular formula H6N3NaO4
and a molecular weight of 135.05 g/mol. Its IUPAC name is sodium;nitric hydrazide;hydroxide;hydrate.
Molecular Properties
| Compound Name | sodium;nitric hydrazide;hydroxide;hydrate |
| PubChem CID | 174819631 |
| Molecular Formula | H6N3NaO4 |
| Molecular Weight | 135.05 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | sodium;nitric hydrazide;hydroxide;hydrate |
| SMILES | NN[N+](=O)[O-].O.[Na+].[OH-] |
| InChI | InChI=1S/H3N3O2.Na.2H2O/c1-2-3(4)5;;;/h2H,1H2;;2*1H2/q;+1;;/p-1 |
| InChIKey | CWTSRGZQUPRTBF-UHFFFAOYSA-M |
| XLogP | -5.36 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.05 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;nitric hydrazide;hydroxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;nitric hydrazide;hydroxide;hydrate?
The IUPAC name of sodium;nitric hydrazide;hydroxide;hydrate (CID 174819631) is sodium;nitric hydrazide;hydroxide;hydrate.
What is the SMILES notation for sodium;nitric hydrazide;hydroxide;hydrate?
The canonical SMILES for sodium;nitric hydrazide;hydroxide;hydrate is NN[N+](=O)[O-].O.[Na+].[OH-].
What is the InChIKey of sodium;nitric hydrazide;hydroxide;hydrate?
The InChIKey is CWTSRGZQUPRTBF-UHFFFAOYSA-M. The full InChI is InChI=1S/H3N3O2.Na.2H2O/c1-2-3(4)5;;;/h2H,1H2;;2*1H2/q;+1;;/p-1.
What are the key properties of sodium;nitric hydrazide;hydroxide;hydrate?
sodium;nitric hydrazide;hydroxide;hydrate has a molecular weight of 135.05 g/mol, XLogP of -5.36, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;nitric hydrazide;hydroxide;hydrate is sourced from PubChem (CID 174819631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).