About sodium;hydride;N-methylnitramide
sodium;hydride;N-methylnitramide (PubChem CID 173405848) has the molecular formula CH5N2NaO2
and a molecular weight of 100.05 g/mol. Its IUPAC name is sodium;hydride;N-methylnitramide.
Molecular Properties
| Compound Name | sodium;hydride;N-methylnitramide |
| PubChem CID | 173405848 |
| Molecular Formula | CH5N2NaO2 |
| Molecular Weight | 100.05 g/mol |
| Exact Mass | 100.02 |
| IUPAC Name | sodium;hydride;N-methylnitramide |
| SMILES | CN[N+](=O)[O-].[H-].[Na+] |
| InChI | InChI=1S/CH4N2O2.Na.H/c1-2-3(4)5;;/h2H,1H3;;/q;+1;-1 |
| InChIKey | HKQFVTBUFZIERS-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.05 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;N-methylnitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;N-methylnitramide?
The IUPAC name of sodium;hydride;N-methylnitramide (CID 173405848) is sodium;hydride;N-methylnitramide.
What is the SMILES notation for sodium;hydride;N-methylnitramide?
The canonical SMILES for sodium;hydride;N-methylnitramide is CN[N+](=O)[O-].[H-].[Na+].
What is the InChIKey of sodium;hydride;N-methylnitramide?
The InChIKey is HKQFVTBUFZIERS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O2.Na.H/c1-2-3(4)5;;/h2H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;N-methylnitramide?
sodium;hydride;N-methylnitramide has a molecular weight of 100.05 g/mol, XLogP of -3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;N-methylnitramide is sourced from PubChem (CID 173405848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).