About sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide
sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide (PubChem CID 173340503) has the molecular formula H2F5N2NaO2S
and a molecular weight of 212.08 g/mol. Its IUPAC name is sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide.
Molecular Properties
| Compound Name | sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide |
| PubChem CID | 173340503 |
| Molecular Formula | H2F5N2NaO2S |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide |
| SMILES | O=[N+]([O-])NS(F)(F)(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/F5HN2O2S.Na.H/c1-10(2,3,4,5)6-7(8)9;;/h6H;;/q;+1;-1 |
| InChIKey | CPXDXABLOVCSBY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide?
The IUPAC name of sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide (CID 173340503) is sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide.
What is the SMILES notation for sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide?
The canonical SMILES for sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide is O=[N+]([O-])NS(F)(F)(F)(F)F.[H-].[Na+].
What is the InChIKey of sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide?
The InChIKey is CPXDXABLOVCSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/F5HN2O2S.Na.H/c1-10(2,3,4,5)6-7(8)9;;/h6H;;/q;+1;-1.
What are the key properties of sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide?
sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide has a molecular weight of 212.08 g/mol, XLogP of -0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;N-(pentafluoro-λ6-sulfanyl)nitramide is sourced from PubChem (CID 173340503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).