About thorium(2+);nitrate;dodecahydrate
thorium(2+);nitrate;dodecahydrate (PubChem CID 18183560) has the molecular formula H24NO15Th+
and a molecular weight of 510.22 g/mol. Its IUPAC name is thorium(2+);nitrate;dodecahydrate.
Molecular Properties
| Compound Name | thorium(2+);nitrate;dodecahydrate |
| PubChem CID | 18183560 |
| Molecular Formula | H24NO15Th+ |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | thorium(2+);nitrate;dodecahydrate |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.O=[N+]([O-])[O-].[Th+2] |
| InChI | InChI=1S/NO3.12H2O.Th/c2-1(3)4;;;;;;;;;;;;;/h;12*1H2;/q-1;;;;;;;;;;;;;+2 |
| InChIKey | OCLHHXNMCMWJBH-UHFFFAOYSA-N |
| XLogP | -10.14 |
| TPSA | 444.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | -10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze thorium(2+);nitrate;dodecahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thorium(2+);nitrate;dodecahydrate?
The IUPAC name of thorium(2+);nitrate;dodecahydrate (CID 18183560) is thorium(2+);nitrate;dodecahydrate.
What is the SMILES notation for thorium(2+);nitrate;dodecahydrate?
The canonical SMILES for thorium(2+);nitrate;dodecahydrate is O.O.O.O.O.O.O.O.O.O.O.O.O=[N+]([O-])[O-].[Th+2].
What is the InChIKey of thorium(2+);nitrate;dodecahydrate?
The InChIKey is OCLHHXNMCMWJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.12H2O.Th/c2-1(3)4;;;;;;;;;;;;;/h;12*1H2;/q-1;;;;;;;;;;;;;+2.
What are the key properties of thorium(2+);nitrate;dodecahydrate?
thorium(2+);nitrate;dodecahydrate has a molecular weight of 510.22 g/mol, XLogP of -10.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thorium(2+);nitrate;dodecahydrate is sourced from PubChem (CID 18183560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).